C11H23INO6P — CID 177020326
2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]phosphoryl]oxyethyl-dimethyl-methyliodanuidylazanium (PubChem CID 177020326) has the molecular formula C11H23INO6P and a molecular weight of 423.18 g/mol. Its IUPAC name is 2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]phosphoryl]oxyethyl-dimethyl-methyliodanuidylazanium.
| Compound Name | 2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]phosphoryl]oxyethyl-dimethyl-methyliodanuidylazanium |
|---|---|
| PubChem CID | 177020326 |
| Molecular Formula | C11H23INO6P |
| Molecular Weight | 423.18 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | 2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]phosphoryl]oxyethyl-dimethyl-methyliodanuidylazanium |
| SMILES | C=C(C)C(=O)OCCOP(=O)(O)OCC[N+](C)(C)[I-]C |
| InChI | InChI=1S/C11H23INO6P/c1-10(2)11(14)17-8-9-19-20(15,16)18-7-6-13(4,5)12-3/h1,6-9H2,2-5H3,(H,15,16) |
| InChIKey | PNYLSHXDKOJPEL-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.18 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|