C6H9Cl2O4P — CID 13363024
2-dichlorophosphoryloxyethyl 2-methylprop-2-enoate (PubChem CID 13363024) has the molecular formula C6H9Cl2O4P and a molecular weight of 247.01 g/mol. Its IUPAC name is 2-dichlorophosphoryloxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-dichlorophosphoryloxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 13363024 |
| Molecular Formula | C6H9Cl2O4P |
| Molecular Weight | 247.01 g/mol |
| Exact Mass | 245.96 |
| IUPAC Name | 2-dichlorophosphoryloxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOP(=O)(Cl)Cl |
| InChI | InChI=1S/C6H9Cl2O4P/c1-5(2)6(9)11-3-4-12-13(7,8)10/h1,3-4H2,2H3 |
| InChIKey | VPKRDJUTURGWHP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.01 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|