C6H9Li2O6P — CID 122611995
dilithium;2-(2-methylprop-2-enoyloxy)ethyl phosphate (PubChem CID 122611995) has the molecular formula C6H9Li2O6P and a molecular weight of 221.99 g/mol. Its IUPAC name is dilithium;2-(2-methylprop-2-enoyloxy)ethyl phosphate.
| Compound Name | dilithium;2-(2-methylprop-2-enoyloxy)ethyl phosphate |
|---|---|
| PubChem CID | 122611995 |
| Molecular Formula | C6H9Li2O6P |
| Molecular Weight | 221.99 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | dilithium;2-(2-methylprop-2-enoyloxy)ethyl phosphate |
| SMILES | C=C(C)C(=O)OCCOP(=O)([O-])[O-].[Li+].[Li+] |
| InChI | InChI=1S/C6H11O6P.2Li/c1-5(2)6(7)11-3-4-12-13(8,9)10;;/h1,3-4H2,2H3,(H2,8,9,10);;/q;2*+1/p-2 |
| InChIKey | VJSCYUHNURSPTA-UHFFFAOYSA-L |
| XLogP | -7.04 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.99 |
| LogP ≤ 5 | -7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|