C6H13O9P2+ — CID 175310560
dihydroxy(oxo)phosphanium;2-phosphonooxyethyl 2-methylprop-2-enoate (PubChem CID 175310560) has the molecular formula C6H13O9P2+ and a molecular weight of 291.11 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;2-phosphonooxyethyl 2-methylprop-2-enoate.
| Compound Name | dihydroxy(oxo)phosphanium;2-phosphonooxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175310560 |
| Molecular Formula | C6H13O9P2+ |
| Molecular Weight | 291.11 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | dihydroxy(oxo)phosphanium;2-phosphonooxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOP(=O)(O)O.O=[P+](O)O |
| InChI | InChI=1S/C6H11O6P.HO3P/c1-5(2)6(7)11-3-4-12-13(8,9)10;1-4(2)3/h1,3-4H2,2H3,(H2,8,9,10);(H-,1,2,3)/p+1 |
| InChIKey | DVKUSTBWBUVHKS-UHFFFAOYSA-O |
| XLogP | -0.16 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.11 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|