C8H14BrO5P — CID 175167107
2-bromoethyl-[2-(2-methylprop-2-enoyloxy)ethoxy]phosphinic acid (PubChem CID 175167107) has the molecular formula C8H14BrO5P and a molecular weight of 301.07 g/mol. Its IUPAC name is 2-bromoethyl-[2-(2-methylprop-2-enoyloxy)ethoxy]phosphinic acid.
| Compound Name | 2-bromoethyl-[2-(2-methylprop-2-enoyloxy)ethoxy]phosphinic acid |
|---|---|
| PubChem CID | 175167107 |
| Molecular Formula | C8H14BrO5P |
| Molecular Weight | 301.07 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 2-bromoethyl-[2-(2-methylprop-2-enoyloxy)ethoxy]phosphinic acid |
| SMILES | C=C(C)C(=O)OCCOP(=O)(O)CCBr |
| InChI | InChI=1S/C8H14BrO5P/c1-7(2)8(10)13-4-5-14-15(11,12)6-3-9/h1,3-6H2,2H3,(H,11,12) |
| InChIKey | PMGGWSACMBDAIV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.07 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|