C9H15O6P — CID 88502358
2-[hydroxy(prop-2-enoxy)phosphoryl]oxyethyl 2-methylprop-2-enoate (PubChem CID 88502358) has the molecular formula C9H15O6P and a molecular weight of 250.19 g/mol. Its IUPAC name is 2-[hydroxy(prop-2-enoxy)phosphoryl]oxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-[hydroxy(prop-2-enoxy)phosphoryl]oxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88502358 |
| Molecular Formula | C9H15O6P |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-[hydroxy(prop-2-enoxy)phosphoryl]oxyethyl 2-methylprop-2-enoate |
| SMILES | C=CCOP(=O)(O)OCCOC(=O)C(=C)C |
| InChI | InChI=1S/C9H15O6P/c1-4-5-14-16(11,12)15-7-6-13-9(10)8(2)3/h4H,1-2,5-7H2,3H3,(H,11,12) |
| InChIKey | FEJLDONKHXYZIC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|