C18H28O13P2 — CID 87608005
2-[bis[2-(2-methylprop-2-enoyloxy)ethoxy]phosphoryloxy-hydroxyphosphoryl]oxyethyl 2-methylprop-2-enoate (PubChem CID 87608005) has the molecular formula C18H28O13P2 and a molecular weight of 514.36 g/mol. Its IUPAC name is 2-[bis[2-(2-methylprop-2-enoyloxy)ethoxy]phosphoryloxy-hydroxyphosphoryl]oxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-[bis[2-(2-methylprop-2-enoyloxy)ethoxy]phosphoryloxy-hydroxyphosphoryl]oxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87608005 |
| Molecular Formula | C18H28O13P2 |
| Molecular Weight | 514.36 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | 2-[bis[2-(2-methylprop-2-enoyloxy)ethoxy]phosphoryloxy-hydroxyphosphoryl]oxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOP(=O)(O)OP(=O)(OCCOC(=O)C(=C)C)OCCOC(=O)C(=C)C |
| InChI | InChI=1S/C18H28O13P2/c1-13(2)16(19)25-7-10-28-32(22,23)31-33(24,29-11-8-26-17(20)14(3)4)30-12-9-27-18(21)15(5)6/h1,3,5,7-12H2,2,4,6H3,(H,22,23) |
| InChIKey | WSZPNHZCKZJIOS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 170.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|