C18H31O10P — CID 59266096
2-[2-[(1S)-1-hydroxy-2-methylprop-2-enoxy]ethoxy-[2-(1-hydroxy-2-methylprop-2-enoxy)ethoxy]phosphoryl]oxyethyl 2-methylprop-2-enoate (PubChem CID 59266096) has the molecular formula C18H31O10P and a molecular weight of 438.41 g/mol. Its IUPAC name is 2-[2-[(1S)-1-hydroxy-2-methylprop-2-enoxy]ethoxy-[2-(1-hydroxy-2-methylprop-2-enoxy)ethoxy]phosphoryl]oxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[(1S)-1-hydroxy-2-methylprop-2-enoxy]ethoxy-[2-(1-hydroxy-2-methylprop-2-enoxy)ethoxy]phosphoryl]oxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59266096 |
| Molecular Formula | C18H31O10P |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 2-[2-[(1S)-1-hydroxy-2-methylprop-2-enoxy]ethoxy-[2-(1-hydroxy-2-methylprop-2-enoxy)ethoxy]phosphoryl]oxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOP(=O)(OCCOC(O)C(=C)C)OCCO[C@H](O)C(=C)C |
| InChI | InChI=1S/C18H31O10P/c1-13(2)16(19)23-7-10-26-29(22,27-11-8-24-17(20)14(3)4)28-12-9-25-18(21)15(5)6/h16-17,19-20H,1,3,5,7-12H2,2,4,6H3/t16-,17?,29?/m0/s1 |
| InChIKey | FEOQHZFIUBMAJJ-ZFDMOAPGSA-N |
| XLogP | 2.09 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|