C30H57N3O10P+3 — CID 139511941
2-[bis[2-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]ethoxy]phosphoryloxy]ethyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium (PubChem CID 139511941) has the molecular formula C30H57N3O10P+3 and a molecular weight of 650.77 g/mol. Its IUPAC name is 2-[bis[2-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]ethoxy]phosphoryloxy]ethyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium.
| Compound Name | 2-[bis[2-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]ethoxy]phosphoryloxy]ethyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 139511941 |
| Molecular Formula | C30H57N3O10P+3 |
| Molecular Weight | 650.77 g/mol |
| Exact Mass | 650.38 |
| IUPAC Name | 2-[bis[2-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]ethoxy]phosphoryloxy]ethyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
| SMILES | C=C(C)C(=O)OCC[N+](C)(C)CCOP(=O)(OCC[N+](C)(C)CCOC(=O)C(=C)C)OCC[N+](C)(C)CCOC(=O)C(=C)C |
| InChI | InChI=1S/C30H57N3O10P/c1-25(2)28(34)38-19-13-31(7,8)16-22-41-44(37,42-23-17-32(9,10)14-20-39-29(35)26(3)4)43-24-18-33(11,12)15-21-40-30(36)27(5)6/h1,3,5,13-24H2,2,4,6-12H3/q+3 |
| InChIKey | OTXHHQUSYMALTG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.77 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|