C11H22NO5P — CID 168739596
2-(2-methylprop-2-enoyloxy)ethyl-[2-(trimethylazaniumyl)ethoxy]phosphinate (PubChem CID 168739596) has the molecular formula C11H22NO5P and a molecular weight of 279.27 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl-[2-(trimethylazaniumyl)ethoxy]phosphinate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl-[2-(trimethylazaniumyl)ethoxy]phosphinate |
|---|---|
| PubChem CID | 168739596 |
| Molecular Formula | C11H22NO5P |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl-[2-(trimethylazaniumyl)ethoxy]phosphinate |
| SMILES | C=C(C)C(=O)OCCP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C11H22NO5P/c1-10(2)11(13)16-8-9-18(14,15)17-7-6-12(3,4)5/h1,6-9H2,2-5H3 |
| InChIKey | AYXIRGPAZTZHMA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|