C10H21NO5S — CID 139835753
methyl sulfite;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium (PubChem CID 139835753) has the molecular formula C10H21NO5S and a molecular weight of 267.35 g/mol. Its IUPAC name is methyl sulfite;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium.
| Compound Name | methyl sulfite;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 139835753 |
| Molecular Formula | C10H21NO5S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | methyl sulfite;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
| SMILES | C=C(C)C(=O)OCC[N+](C)(C)C.COS(=O)[O-] |
| InChI | InChI=1S/C9H18NO2.CH4O3S/c1-8(2)9(11)12-7-6-10(3,4)5;1-4-5(2)3/h1,6-7H2,2-5H3;1H3,(H,2,3)/q+1;/p-1 |
| InChIKey | VVXBWTRAMOGWSZ-UHFFFAOYSA-M |
| XLogP | 0.24 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|