C19H34NO6+ — CID 87802810
ethyl prop-2-enoate;methyl 2-methylprop-2-enoate;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium (PubChem CID 87802810) has the molecular formula C19H34NO6+ and a molecular weight of 372.48 g/mol. Its IUPAC name is ethyl prop-2-enoate;methyl 2-methylprop-2-enoate;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium.
| Compound Name | ethyl prop-2-enoate;methyl 2-methylprop-2-enoate;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 87802810 |
| Molecular Formula | C19H34NO6+ |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | ethyl prop-2-enoate;methyl 2-methylprop-2-enoate;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)OCC[N+](C)(C)C.C=CC(=O)OCC |
| InChI | InChI=1S/C9H18NO2.2C5H8O2/c1-8(2)9(11)12-7-6-10(3,4)5;1-4(2)5(6)7-3;1-3-5(6)7-4-2/h1,6-7H2,2-5H3;1H2,2-3H3;3H,1,4H2,2H3/q+1;; |
| InChIKey | PDJZNZACAZYMJX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|