About ethyl prop-2-enoate;ethyl(trimethyl)azanium
ethyl prop-2-enoate;ethyl(trimethyl)azanium (PubChem CID 175893941) has the molecular formula C10H22NO2+
and a molecular weight of 188.29 g/mol. Its IUPAC name is ethyl prop-2-enoate;ethyl(trimethyl)azanium.
Molecular Properties
| Compound Name | ethyl prop-2-enoate;ethyl(trimethyl)azanium |
| PubChem CID | 175893941 |
| Molecular Formula | C10H22NO2+ |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | ethyl prop-2-enoate;ethyl(trimethyl)azanium |
| SMILES | C=CC(=O)OCC.CC[N+](C)(C)C |
| InChI | InChI=1S/C5H14N.C5H8O2/c1-5-6(2,3)4;1-3-5(6)7-4-2/h5H2,1-4H3;3H,1,4H2,2H3/q+1; |
| InChIKey | DPXMUZUNNWLEOV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl prop-2-enoate;ethyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl prop-2-enoate;ethyl(trimethyl)azanium?
The IUPAC name of ethyl prop-2-enoate;ethyl(trimethyl)azanium (CID 175893941) is ethyl prop-2-enoate;ethyl(trimethyl)azanium.
What is the SMILES notation for ethyl prop-2-enoate;ethyl(trimethyl)azanium?
The canonical SMILES for ethyl prop-2-enoate;ethyl(trimethyl)azanium is C=CC(=O)OCC.CC[N+](C)(C)C.
What is the InChIKey of ethyl prop-2-enoate;ethyl(trimethyl)azanium?
The InChIKey is DPXMUZUNNWLEOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N.C5H8O2/c1-5-6(2,3)4;1-3-5(6)7-4-2/h5H2,1-4H3;3H,1,4H2,2H3/q+1;.
What are the key properties of ethyl prop-2-enoate;ethyl(trimethyl)azanium?
ethyl prop-2-enoate;ethyl(trimethyl)azanium has a molecular weight of 188.29 g/mol, XLogP of 1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl prop-2-enoate;ethyl(trimethyl)azanium is sourced from PubChem (CID 175893941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).