About ethyl prop-2-enoate;hydroiodide
ethyl prop-2-enoate;hydroiodide (PubChem CID 159738872) has the molecular formula C5H9IO2
and a molecular weight of 228.03 g/mol. Its IUPAC name is ethyl prop-2-enoate;hydroiodide.
Molecular Properties
| Compound Name | ethyl prop-2-enoate;hydroiodide |
| PubChem CID | 159738872 |
| Molecular Formula | C5H9IO2 |
| Molecular Weight | 228.03 g/mol |
| Exact Mass | 227.96 |
| IUPAC Name | ethyl prop-2-enoate;hydroiodide |
| SMILES | C=CC(=O)OCC.I |
| InChI | InChI=1S/C5H8O2.HI/c1-3-5(6)7-4-2;/h3H,1,4H2,2H3;1H |
| InChIKey | FZWANRRPZRWNCF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.03 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl prop-2-enoate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl prop-2-enoate;hydroiodide?
The IUPAC name of ethyl prop-2-enoate;hydroiodide (CID 159738872) is ethyl prop-2-enoate;hydroiodide.
What is the SMILES notation for ethyl prop-2-enoate;hydroiodide?
The canonical SMILES for ethyl prop-2-enoate;hydroiodide is C=CC(=O)OCC.I.
What is the InChIKey of ethyl prop-2-enoate;hydroiodide?
The InChIKey is FZWANRRPZRWNCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.HI/c1-3-5(6)7-4-2;/h3H,1,4H2,2H3;1H.
What are the key properties of ethyl prop-2-enoate;hydroiodide?
ethyl prop-2-enoate;hydroiodide has a molecular weight of 228.03 g/mol, XLogP of 1.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl prop-2-enoate;hydroiodide is sourced from PubChem (CID 159738872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).