C14H23ClO6 — CID 174378741
chloromethane;ethyl prop-2-enoate;methyl 2-methylprop-2-enoate;prop-2-enoic acid (PubChem CID 174378741) has the molecular formula C14H23ClO6 and a molecular weight of 322.79 g/mol. Its IUPAC name is chloromethane;ethyl prop-2-enoate;methyl 2-methylprop-2-enoate;prop-2-enoic acid.
| Compound Name | chloromethane;ethyl prop-2-enoate;methyl 2-methylprop-2-enoate;prop-2-enoic acid |
|---|---|
| PubChem CID | 174378741 |
| Molecular Formula | C14H23ClO6 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | chloromethane;ethyl prop-2-enoate;methyl 2-methylprop-2-enoate;prop-2-enoic acid |
| SMILES | C=C(C)C(=O)OC.C=CC(=O)O.C=CC(=O)OCC.CCl |
| InChI | InChI=1S/2C5H8O2.C3H4O2.CH3Cl/c1-4(2)5(6)7-3;1-3-5(6)7-4-2;1-2-3(4)5;1-2/h1H2,2-3H3;3H,1,4H2,2H3;2H,1H2,(H,4,5);1H3 |
| InChIKey | GLDMMLPMOSSEAO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|