C13H24O5Si — CID 174956610
3-ethoxysilylpropyl prop-2-enoate;methyl 2-methylprop-2-enoate (PubChem CID 174956610) has the molecular formula C13H24O5Si and a molecular weight of 288.42 g/mol. Its IUPAC name is 3-ethoxysilylpropyl prop-2-enoate;methyl 2-methylprop-2-enoate.
| Compound Name | 3-ethoxysilylpropyl prop-2-enoate;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174956610 |
| Molecular Formula | C13H24O5Si |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3-ethoxysilylpropyl prop-2-enoate;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=CC(=O)OCCC[SiH2]OCC |
| InChI | InChI=1S/C8H16O3Si.C5H8O2/c1-3-8(9)10-6-5-7-12-11-4-2;1-4(2)5(6)7-3/h3H,1,4-7,12H2,2H3;1H2,2-3H3 |
| InChIKey | XGKPOSPAUKGRIC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|