About 3-ethoxysilylpropyl prop-2-enoate;triethoxysilane
3-ethoxysilylpropyl prop-2-enoate;triethoxysilane (PubChem CID 157454535) has the molecular formula C14H32O6Si2
and a molecular weight of 352.58 g/mol. Its IUPAC name is 3-ethoxysilylpropyl prop-2-enoate;triethoxysilane.
Molecular Properties
| Compound Name | 3-ethoxysilylpropyl prop-2-enoate;triethoxysilane |
| PubChem CID | 157454535 |
| Molecular Formula | C14H32O6Si2 |
| Molecular Weight | 352.58 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 3-ethoxysilylpropyl prop-2-enoate;triethoxysilane |
| SMILES | C=CC(=O)OCCC[SiH2]OCC.CCO[SiH](OCC)OCC |
| InChI | InChI=1S/C8H16O3Si.C6H16O3Si/c1-3-8(9)10-6-5-7-12-11-4-2;1-4-7-10(8-5-2)9-6-3/h3H,1,4-7,12H2,2H3;10H,4-6H2,1-3H3 |
| InChIKey | BTERVQLEXBFOIO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.58 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxysilylpropyl prop-2-enoate;triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxysilylpropyl prop-2-enoate;triethoxysilane?
The IUPAC name of 3-ethoxysilylpropyl prop-2-enoate;triethoxysilane (CID 157454535) is 3-ethoxysilylpropyl prop-2-enoate;triethoxysilane.
What is the SMILES notation for 3-ethoxysilylpropyl prop-2-enoate;triethoxysilane?
The canonical SMILES for 3-ethoxysilylpropyl prop-2-enoate;triethoxysilane is C=CC(=O)OCCC[SiH2]OCC.CCO[SiH](OCC)OCC.
What is the InChIKey of 3-ethoxysilylpropyl prop-2-enoate;triethoxysilane?
The InChIKey is BTERVQLEXBFOIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3Si.C6H16O3Si/c1-3-8(9)10-6-5-7-12-11-4-2;1-4-7-10(8-5-2)9-6-3/h3H,1,4-7,12H2,2H3;10H,4-6H2,1-3H3.
What are the key properties of 3-ethoxysilylpropyl prop-2-enoate;triethoxysilane?
3-ethoxysilylpropyl prop-2-enoate;triethoxysilane has a molecular weight of 352.58 g/mol, XLogP of 1.46, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxysilylpropyl prop-2-enoate;triethoxysilane is sourced from PubChem (CID 157454535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).