About 6-ethoxyhexyl prop-2-enoate
6-ethoxyhexyl prop-2-enoate (PubChem CID 88877184) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 6-ethoxyhexyl prop-2-enoate.
Molecular Properties
| Compound Name | 6-ethoxyhexyl prop-2-enoate |
| PubChem CID | 88877184 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 6-ethoxyhexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOCC |
| InChI | InChI=1S/C11H20O3/c1-3-11(12)14-10-8-6-5-7-9-13-4-2/h3H,1,4-10H2,2H3 |
| InChIKey | XVSIWJMHGOQYQI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-ethoxyhexyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxyhexyl prop-2-enoate?
The IUPAC name of 6-ethoxyhexyl prop-2-enoate (CID 88877184) is 6-ethoxyhexyl prop-2-enoate.
What is the SMILES notation for 6-ethoxyhexyl prop-2-enoate?
The canonical SMILES for 6-ethoxyhexyl prop-2-enoate is C=CC(=O)OCCCCCCOCC.
What is the InChIKey of 6-ethoxyhexyl prop-2-enoate?
The InChIKey is XVSIWJMHGOQYQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-3-11(12)14-10-8-6-5-7-9-13-4-2/h3H,1,4-10H2,2H3.
What are the key properties of 6-ethoxyhexyl prop-2-enoate?
6-ethoxyhexyl prop-2-enoate has a molecular weight of 200.28 g/mol, XLogP of 2.31, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxyhexyl prop-2-enoate is sourced from PubChem (CID 88877184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).