C16H30O7 — CID 155023920
ethane-1,2-diol;ethoxyethane;4-prop-2-enoyloxybutyl prop-2-enoate (PubChem CID 155023920) has the molecular formula C16H30O7 and a molecular weight of 334.41 g/mol. Its IUPAC name is ethane-1,2-diol;ethoxyethane;4-prop-2-enoyloxybutyl prop-2-enoate.
| Compound Name | ethane-1,2-diol;ethoxyethane;4-prop-2-enoyloxybutyl prop-2-enoate |
|---|---|
| PubChem CID | 155023920 |
| Molecular Formula | C16H30O7 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | ethane-1,2-diol;ethoxyethane;4-prop-2-enoyloxybutyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOC(=O)C=C.CCOCC.OCCO |
| InChI | InChI=1S/C10H14O4.C4H10O.C2H6O2/c1-3-9(11)13-7-5-6-8-14-10(12)4-2;1-3-5-4-2;3-1-2-4/h3-4H,1-2,5-8H2;3-4H2,1-2H3;3-4H,1-2H2 |
| InChIKey | CBXSAGHHGLFBGB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|