C17H30O6 — CID 174792741
2-(2-ethoxyethoxy)ethyl prop-2-enoate;pentyl prop-2-enoate (PubChem CID 174792741) has the molecular formula C17H30O6 and a molecular weight of 330.42 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)ethyl prop-2-enoate;pentyl prop-2-enoate.
| Compound Name | 2-(2-ethoxyethoxy)ethyl prop-2-enoate;pentyl prop-2-enoate |
|---|---|
| PubChem CID | 174792741 |
| Molecular Formula | C17H30O6 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 2-(2-ethoxyethoxy)ethyl prop-2-enoate;pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCC.C=CC(=O)OCCOCCOCC |
| InChI | InChI=1S/C9H16O4.C8H14O2/c1-3-9(10)13-8-7-12-6-5-11-4-2;1-3-5-6-7-10-8(9)4-2/h3H,1,4-8H2,2H3;4H,2-3,5-7H2,1H3 |
| InChIKey | DRZBJNVXVTZJET-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|