C57H112O15 — CID 22918013
4-[4-[4-[4-[4-[4-[4-[4-[4-[4-[4-[4-(4-ethoxybutoxy)butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butyl prop-2-enoate (PubChem CID 22918013) has the molecular formula C57H112O15 and a molecular weight of 1037.51 g/mol. Its IUPAC name is 4-[4-[4-[4-[4-[4-[4-[4-[4-[4-[4-[4-(4-ethoxybutoxy)butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butyl prop-2-enoate.
| Compound Name | 4-[4-[4-[4-[4-[4-[4-[4-[4-[4-[4-[4-(4-ethoxybutoxy)butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 22918013 |
| Molecular Formula | C57H112O15 |
| Molecular Weight | 1037.51 g/mol |
| Exact Mass | 1036.80 |
| IUPAC Name | 4-[4-[4-[4-[4-[4-[4-[4-[4-[4-[4-[4-(4-ethoxybutoxy)butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butoxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOCCCCOCCCCOCCCCOCCCCOCCCCOCCCCOCCCCOCCCCOCCCCOCCCCOCCCCOCCCCOCC |
| InChI | InChI=1S/C57H112O15/c1-3-57(58)72-56-30-29-55-71-54-28-27-53-70-52-26-25-51-69-50-24-23-49-68-48-22-21-47-67-46-20-19-45-66-44-18-17-43-65-42-16-15-41-64-40-14-13-39-63-38-12-11-37-62-36-10-9-35-61-34-8-7-33-60-32-6-5-31-59-4-2/h3H,1,4-56H2,2H3 |
| InChIKey | USOGXLSSOJNBFR-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 146.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 67 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1037.51 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|