C24H42O10 — CID 101134249
2-[2-[2-[6-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]hexoxy]ethoxy]ethoxy]ethyl prop-2-enoate (PubChem CID 101134249) has the molecular formula C24H42O10 and a molecular weight of 490.59 g/mol. Its IUPAC name is 2-[2-[2-[6-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]hexoxy]ethoxy]ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-[2-[6-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]hexoxy]ethoxy]ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 101134249 |
| Molecular Formula | C24H42O10 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 2-[2-[2-[6-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]hexoxy]ethoxy]ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCOCCOCCCCCCOCCOCCOCCOC(=O)C=C |
| InChI | InChI=1S/C24H42O10/c1-3-23(25)33-21-19-31-17-15-29-13-11-27-9-7-5-6-8-10-28-12-14-30-16-18-32-20-22-34-24(26)4-2/h3-4H,1-2,5-22H2 |
| InChIKey | VEBWBEARTLNLME-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|