C16H28O6 — CID 153320146
2-[6-(2-prop-2-enoyloxyethoxy)hexoxy]ethyl propanoate (PubChem CID 153320146) has the molecular formula C16H28O6 and a molecular weight of 316.39 g/mol. Its IUPAC name is 2-[6-(2-prop-2-enoyloxyethoxy)hexoxy]ethyl propanoate.
| Compound Name | 2-[6-(2-prop-2-enoyloxyethoxy)hexoxy]ethyl propanoate |
|---|---|
| PubChem CID | 153320146 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 2-[6-(2-prop-2-enoyloxyethoxy)hexoxy]ethyl propanoate |
| SMILES | C=CC(=O)OCCOCCCCCCOCCOC(=O)CC |
| InChI | InChI=1S/C16H28O6/c1-3-15(17)21-13-11-19-9-7-5-6-8-10-20-12-14-22-16(18)4-2/h3H,1,4-14H2,2H3 |
| InChIKey | UIHZFIAJJWJLSM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|