C25H42O12 — CID 89084261
2-[2,2-bis(2-propanoyloxyethoxymethyl)-3-(2-prop-2-enoyloxyethoxy)propoxy]ethyl propanoate (PubChem CID 89084261) has the molecular formula C25H42O12 and a molecular weight of 534.60 g/mol. Its IUPAC name is 2-[2,2-bis(2-propanoyloxyethoxymethyl)-3-(2-prop-2-enoyloxyethoxy)propoxy]ethyl propanoate.
| Compound Name | 2-[2,2-bis(2-propanoyloxyethoxymethyl)-3-(2-prop-2-enoyloxyethoxy)propoxy]ethyl propanoate |
|---|---|
| PubChem CID | 89084261 |
| Molecular Formula | C25H42O12 |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | 2-[2,2-bis(2-propanoyloxyethoxymethyl)-3-(2-prop-2-enoyloxyethoxy)propoxy]ethyl propanoate |
| SMILES | C=CC(=O)OCCOCC(COCCOC(=O)CC)(COCCOC(=O)CC)COCCOC(=O)CC |
| InChI | InChI=1S/C25H42O12/c1-5-21(26)34-13-9-30-17-25(18-31-10-14-35-22(27)6-2,19-32-11-15-36-23(28)7-3)20-33-12-16-37-24(29)8-4/h5H,1,6-20H2,2-4H3 |
| InChIKey | HDRHDZCJYGTPNY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|