C22H36O9 — CID 162466321
2-[2,2-bis(2-prop-2-enoyloxyethoxymethyl)butoxy]ethyl butanoate (PubChem CID 162466321) has the molecular formula C22H36O9 and a molecular weight of 444.52 g/mol. Its IUPAC name is 2-[2,2-bis(2-prop-2-enoyloxyethoxymethyl)butoxy]ethyl butanoate.
| Compound Name | 2-[2,2-bis(2-prop-2-enoyloxyethoxymethyl)butoxy]ethyl butanoate |
|---|---|
| PubChem CID | 162466321 |
| Molecular Formula | C22H36O9 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 2-[2,2-bis(2-prop-2-enoyloxyethoxymethyl)butoxy]ethyl butanoate |
| SMILES | C=CC(=O)OCCOCC(CC)(COCCOC(=O)C=C)COCCOC(=O)CCC |
| InChI | InChI=1S/C22H36O9/c1-5-9-21(25)31-15-12-28-18-22(8-4,16-26-10-13-29-19(23)6-2)17-27-11-14-30-20(24)7-3/h6-7H,2-3,5,8-18H2,1,4H3 |
| InChIKey | XCIFWIKREOIMQS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|