C28H51NO12Si — CID 58918751
2-[2,2-bis(2-prop-2-enoyloxyethoxymethyl)butoxy]ethyl 3-[methyl(3-trimethoxysilylpropyl)amino]propanoate (PubChem CID 58918751) has the molecular formula C28H51NO12Si and a molecular weight of 621.80 g/mol. Its IUPAC name is 2-[2,2-bis(2-prop-2-enoyloxyethoxymethyl)butoxy]ethyl 3-[methyl(3-trimethoxysilylpropyl)amino]propanoate.
| Compound Name | 2-[2,2-bis(2-prop-2-enoyloxyethoxymethyl)butoxy]ethyl 3-[methyl(3-trimethoxysilylpropyl)amino]propanoate |
|---|---|
| PubChem CID | 58918751 |
| Molecular Formula | C28H51NO12Si |
| Molecular Weight | 621.80 g/mol |
| Exact Mass | 621.32 |
| IUPAC Name | 2-[2,2-bis(2-prop-2-enoyloxyethoxymethyl)butoxy]ethyl 3-[methyl(3-trimethoxysilylpropyl)amino]propanoate |
| SMILES | C=CC(=O)OCCOCC(CC)(COCCOC(=O)C=C)COCCOC(=O)CCN(C)CCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C28H51NO12Si/c1-8-25(30)39-18-15-36-22-28(10-3,23-37-16-19-40-26(31)9-2)24-38-17-20-41-27(32)12-14-29(4)13-11-21-42(33-5,34-6)35-7/h8-9H,1-2,10-24H2,3-7H3 |
| InChIKey | LCOCKHFNEJLGQP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 137.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.80 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|