C12H24O7Si — CID 171586967
2-[2-(2-trimethoxysilylethoxy)ethoxy]ethyl prop-2-enoate (PubChem CID 171586967) has the molecular formula C12H24O7Si and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-[2-(2-trimethoxysilylethoxy)ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-(2-trimethoxysilylethoxy)ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 171586967 |
| Molecular Formula | C12H24O7Si |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-[2-(2-trimethoxysilylethoxy)ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCOCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C12H24O7Si/c1-5-12(13)19-9-8-17-6-7-18-10-11-20(14-2,15-3)16-4/h5H,1,6-11H2,2-4H3 |
| InChIKey | STVHUBDBHLBNGB-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|