C12H20O5 — CID 141287577
2-[2-(2-prop-1-en-2-yloxyethoxy)ethoxy]ethyl prop-2-enoate (PubChem CID 141287577) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-[2-(2-prop-1-en-2-yloxyethoxy)ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-(2-prop-1-en-2-yloxyethoxy)ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 141287577 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-[2-(2-prop-1-en-2-yloxyethoxy)ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCOCCOC(=C)C |
| InChI | InChI=1S/C12H20O5/c1-4-12(13)17-10-8-15-6-5-14-7-9-16-11(2)3/h4H,1-2,5-10H2,3H3 |
| InChIKey | VXAASVCBHKYIEB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|