C17H30O8 — CID 87967520
2-(2-methoxyethoxy)ethyl 2-methylprop-2-enoate;2-(2-methoxyethoxy)ethyl prop-2-enoate (PubChem CID 87967520) has the molecular formula C17H30O8 and a molecular weight of 362.42 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl 2-methylprop-2-enoate;2-(2-methoxyethoxy)ethyl prop-2-enoate.
| Compound Name | 2-(2-methoxyethoxy)ethyl 2-methylprop-2-enoate;2-(2-methoxyethoxy)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 87967520 |
| Molecular Formula | C17H30O8 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl 2-methylprop-2-enoate;2-(2-methoxyethoxy)ethyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCOC.C=CC(=O)OCCOCCOC |
| InChI | InChI=1S/C9H16O4.C8H14O4/c1-8(2)9(10)13-7-6-12-5-4-11-3;1-3-8(9)12-7-6-11-5-4-10-2/h1,4-7H2,2-3H3;3H,1,4-7H2,2H3 |
| InChIKey | TYBJSNRNPBGRFC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|