C24H36O11 — CID 160886159
2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethyl prop-2-enoate (PubChem CID 160886159) has the molecular formula C24H36O11 and a molecular weight of 500.54 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 160886159 |
| Molecular Formula | C24H36O11 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(=C)C.C=CC(=O)OCCOCCOCCOCCOC(=O)C=C |
| InChI | InChI=1S/C14H22O7.C10H14O4/c1-3-13(15)20-11-9-18-7-5-17-6-8-19-10-12-21-14(16)4-2;1-7(2)9(11)13-5-6-14-10(12)8(3)4/h3-4H,1-2,5-12H2;1,3,5-6H2,2,4H3 |
| InChIKey | SNQWFWZPUXLKJD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|