C15H18O8 — CID 178063715
4-O-[2-(2-methylprop-2-enoyloxy)ethyl] 1-O-(2-prop-2-enoyloxyethyl) (E)-but-2-enedioate (PubChem CID 178063715) has the molecular formula C15H18O8 and a molecular weight of 326.30 g/mol. Its IUPAC name is 4-O-[2-(2-methylprop-2-enoyloxy)ethyl] 1-O-(2-prop-2-enoyloxyethyl) (E)-but-2-enedioate.
| Compound Name | 4-O-[2-(2-methylprop-2-enoyloxy)ethyl] 1-O-(2-prop-2-enoyloxyethyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 178063715 |
| Molecular Formula | C15H18O8 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 4-O-[2-(2-methylprop-2-enoyloxy)ethyl] 1-O-(2-prop-2-enoyloxyethyl) (E)-but-2-enedioate |
| SMILES | C=CC(=O)OCCOC(=O)/C=C/C(=O)OCCOC(=O)C(=C)C |
| InChI | InChI=1S/C15H18O8/c1-4-12(16)20-7-8-21-13(17)5-6-14(18)22-9-10-23-15(19)11(2)3/h4-6H,1-2,7-10H2,3H3/b6-5+ |
| InChIKey | LVRVDPCORZVXOH-AATRIKPKSA-N |
| XLogP | 0.48 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|