C13H16N2O4 — CID 175522634
2-cyanoethyl 2-methylprop-2-enoate;2-cyanoethyl prop-2-enoate (PubChem CID 175522634) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-cyanoethyl 2-methylprop-2-enoate;2-cyanoethyl prop-2-enoate.
| Compound Name | 2-cyanoethyl 2-methylprop-2-enoate;2-cyanoethyl prop-2-enoate |
|---|---|
| PubChem CID | 175522634 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-cyanoethyl 2-methylprop-2-enoate;2-cyanoethyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC#N.C=CC(=O)OCCC#N |
| InChI | InChI=1S/C7H9NO2.C6H7NO2/c1-6(2)7(9)10-5-3-4-8;1-2-6(8)9-5-3-4-7/h1,3,5H2,2H3;2H,1,3,5H2 |
| InChIKey | UABCJBGFXKAJAB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|