About 2-cyanoethyl 2-methylprop-2-enoate;3-cyanopropanoic acid
2-cyanoethyl 2-methylprop-2-enoate;3-cyanopropanoic acid (PubChem CID 174752045) has the molecular formula C11H14N2O4
and a molecular weight of 238.24 g/mol. Its IUPAC name is 2-cyanoethyl 2-methylprop-2-enoate;3-cyanopropanoic acid.
Molecular Properties
| Compound Name | 2-cyanoethyl 2-methylprop-2-enoate;3-cyanopropanoic acid |
| PubChem CID | 174752045 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-cyanoethyl 2-methylprop-2-enoate;3-cyanopropanoic acid |
| SMILES | C=C(C)C(=O)OCCC#N.N#CCCC(=O)O |
| InChI | InChI=1S/C7H9NO2.C4H5NO2/c1-6(2)7(9)10-5-3-4-8;5-3-1-2-4(6)7/h1,3,5H2,2H3;1-2H2,(H,6,7) |
| InChIKey | RBXZCKXEXVKBAT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoethyl 2-methylprop-2-enoate;3-cyanopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoethyl 2-methylprop-2-enoate;3-cyanopropanoic acid?
The IUPAC name of 2-cyanoethyl 2-methylprop-2-enoate;3-cyanopropanoic acid (CID 174752045) is 2-cyanoethyl 2-methylprop-2-enoate;3-cyanopropanoic acid.
What is the SMILES notation for 2-cyanoethyl 2-methylprop-2-enoate;3-cyanopropanoic acid?
The canonical SMILES for 2-cyanoethyl 2-methylprop-2-enoate;3-cyanopropanoic acid is C=C(C)C(=O)OCCC#N.N#CCCC(=O)O.
What is the InChIKey of 2-cyanoethyl 2-methylprop-2-enoate;3-cyanopropanoic acid?
The InChIKey is RBXZCKXEXVKBAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2.C4H5NO2/c1-6(2)7(9)10-5-3-4-8;5-3-1-2-4(6)7/h1,3,5H2,2H3;1-2H2,(H,6,7).
What are the key properties of 2-cyanoethyl 2-methylprop-2-enoate;3-cyanopropanoic acid?
2-cyanoethyl 2-methylprop-2-enoate;3-cyanopropanoic acid has a molecular weight of 238.24 g/mol, XLogP of 1.39, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoethyl 2-methylprop-2-enoate;3-cyanopropanoic acid is sourced from PubChem (CID 174752045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).