C10H18N2O3 — CID 164532227
2-(2-cyanoethoxymethylamino)ethyl 2-methylprop-2-enoate;molecular hydrogen (PubChem CID 164532227) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-(2-cyanoethoxymethylamino)ethyl 2-methylprop-2-enoate;molecular hydrogen.
| Compound Name | 2-(2-cyanoethoxymethylamino)ethyl 2-methylprop-2-enoate;molecular hydrogen |
|---|---|
| PubChem CID | 164532227 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 2-(2-cyanoethoxymethylamino)ethyl 2-methylprop-2-enoate;molecular hydrogen |
| SMILES | C=C(C)C(=O)OCCNCOCCC#N.[H][H] |
| InChI | InChI=1S/C10H16N2O3.H2/c1-9(2)10(13)15-7-5-12-8-14-6-3-4-11;/h12H,1,3,5-8H2,2H3;1H |
| InChIKey | GUYKCTDLKMEFDJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|