C9H17NO4 — CID 163863615
2-[[(2S)-2,3-dihydroxypropyl]amino]ethyl 2-methylprop-2-enoate (PubChem CID 163863615) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is 2-[[(2S)-2,3-dihydroxypropyl]amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[(2S)-2,3-dihydroxypropyl]amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163863615 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 2-[[(2S)-2,3-dihydroxypropyl]amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC[C@H](O)CO |
| InChI | InChI=1S/C9H17NO4/c1-7(2)9(13)14-4-3-10-5-8(12)6-11/h8,10-12H,1,3-6H2,2H3/t8-/m0/s1 |
| InChIKey | PESHEKNULIEGPI-QMMMGPOBSA-N |
| XLogP | -0.95 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|