C12H18O5 — CID 19428981
[3-hydroxy-4-(2-methylprop-2-enoyloxy)butyl] 2-methylprop-2-enoate (PubChem CID 19428981) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is [3-hydroxy-4-(2-methylprop-2-enoyloxy)butyl] 2-methylprop-2-enoate.
| Compound Name | [3-hydroxy-4-(2-methylprop-2-enoyloxy)butyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 19428981 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | [3-hydroxy-4-(2-methylprop-2-enoyloxy)butyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(O)COC(=O)C(=C)C |
| InChI | InChI=1S/C12H18O5/c1-8(2)11(14)16-6-5-10(13)7-17-12(15)9(3)4/h10,13H,1,3,5-7H2,2,4H3 |
| InChIKey | BMZNPMGHSKFKTH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|