C19H28O10 — CID 170691807
1-O-[2-hydroxy-4-(2-methylprop-2-enoyloxy)butyl] 4-O-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] butanedioate (PubChem CID 170691807) has the molecular formula C19H28O10 and a molecular weight of 416.42 g/mol. Its IUPAC name is 1-O-[2-hydroxy-4-(2-methylprop-2-enoyloxy)butyl] 4-O-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] butanedioate.
| Compound Name | 1-O-[2-hydroxy-4-(2-methylprop-2-enoyloxy)butyl] 4-O-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] butanedioate |
|---|---|
| PubChem CID | 170691807 |
| Molecular Formula | C19H28O10 |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 1-O-[2-hydroxy-4-(2-methylprop-2-enoyloxy)butyl] 4-O-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] butanedioate |
| SMILES | C=C(C)C(=O)OCCC(O)COC(=O)CCC(=O)OCC(O)COC(=O)C(=C)C |
| InChI | InChI=1S/C19H28O10/c1-12(2)18(24)26-8-7-14(20)9-27-16(22)5-6-17(23)28-10-15(21)11-29-19(25)13(3)4/h14-15,20-21H,1,3,5-11H2,2,4H3 |
| InChIKey | SFVLAXHSKMCLTJ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|