C20H28O10 — CID 20697152
bis[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] (E)-hex-3-enedioate (PubChem CID 20697152) has the molecular formula C20H28O10 and a molecular weight of 428.43 g/mol. Its IUPAC name is bis[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] (E)-hex-3-enedioate.
| Compound Name | bis[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] (E)-hex-3-enedioate |
|---|---|
| PubChem CID | 20697152 |
| Molecular Formula | C20H28O10 |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | bis[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] (E)-hex-3-enedioate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)C/C=C/CC(=O)OCC(O)COC(=O)C(=C)C |
| InChI | InChI=1S/C20H28O10/c1-13(2)19(25)29-11-15(21)9-27-17(23)7-5-6-8-18(24)28-10-16(22)12-30-20(26)14(3)4/h5-6,15-16,21-22H,1,3,7-12H2,2,4H3/b6-5+ |
| InChIKey | KLTBTLOCBATUNC-AATRIKPKSA-N |
| XLogP | 0.37 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|