C17H26O10S2 — CID 139453971
[3-[3-[[3-(3-formyloxy-2-hydroxypropoxy)-3-oxopropyl]disulfanyl]propanoyloxy]-2-hydroxypropyl] 2-methylprop-2-enoate (PubChem CID 139453971) has the molecular formula C17H26O10S2 and a molecular weight of 454.52 g/mol. Its IUPAC name is [3-[3-[[3-(3-formyloxy-2-hydroxypropoxy)-3-oxopropyl]disulfanyl]propanoyloxy]-2-hydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[3-[[3-(3-formyloxy-2-hydroxypropoxy)-3-oxopropyl]disulfanyl]propanoyloxy]-2-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139453971 |
| Molecular Formula | C17H26O10S2 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | [3-[3-[[3-(3-formyloxy-2-hydroxypropoxy)-3-oxopropyl]disulfanyl]propanoyloxy]-2-hydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)CCSSCCC(=O)OCC(O)COC=O |
| InChI | InChI=1S/C17H26O10S2/c1-12(2)17(23)27-10-14(20)9-26-16(22)4-6-29-28-5-3-15(21)25-8-13(19)7-24-11-18/h11,13-14,19-20H,1,3-10H2,2H3 |
| InChIKey | UCELIRVTQSYIJI-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|