C9H14O6 — CID 139917348
(2-hydroxy-3-methoxycarbonyloxypropyl) 2-methylprop-2-enoate (PubChem CID 139917348) has the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. Its IUPAC name is (2-hydroxy-3-methoxycarbonyloxypropyl) 2-methylprop-2-enoate.
| Compound Name | (2-hydroxy-3-methoxycarbonyloxypropyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139917348 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (2-hydroxy-3-methoxycarbonyloxypropyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)OC |
| InChI | InChI=1S/C9H14O6/c1-6(2)8(11)14-4-7(10)5-15-9(12)13-3/h7,10H,1,4-5H2,2-3H3 |
| InChIKey | HHOWILKKUZGMJM-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|