C8H13NO4 — CID 87605994
(4-amino-2-hydroxy-4-oxobutyl) 2-methylprop-2-enoate (PubChem CID 87605994) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is (4-amino-2-hydroxy-4-oxobutyl) 2-methylprop-2-enoate.
| Compound Name | (4-amino-2-hydroxy-4-oxobutyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87605994 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (4-amino-2-hydroxy-4-oxobutyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)CC(N)=O |
| InChI | InChI=1S/C8H13NO4/c1-5(2)8(12)13-4-6(10)3-7(9)11/h6,10H,1,3-4H2,2H3,(H2,9,11) |
| InChIKey | IVKOAWNOYDIVQI-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|