C8H15N2O3S+ — CID 20727766
[amino-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]sulfanylmethylidene]azanium (PubChem CID 20727766) has the molecular formula C8H15N2O3S+ and a molecular weight of 219.29 g/mol. Its IUPAC name is [amino-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]sulfanylmethylidene]azanium.
| Compound Name | [amino-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]sulfanylmethylidene]azanium |
|---|---|
| PubChem CID | 20727766 |
| Molecular Formula | C8H15N2O3S+ |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | [amino-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]sulfanylmethylidene]azanium |
| SMILES | C=C(C)C(=O)OCC(O)CSC(N)=[NH2+] |
| InChI | InChI=1S/C8H14N2O3S/c1-5(2)7(12)13-3-6(11)4-14-8(9)10/h6,11H,1,3-4H2,2H3,(H3,9,10)/p+1 |
| InChIKey | BRRNUUNUUIXEGA-UHFFFAOYSA-O |
| XLogP | -1.73 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|