C12H24ClNO3 — CID 19800674
diethyl-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]-methylazanium chloride (PubChem CID 19800674) has the molecular formula C12H24ClNO3 and a molecular weight of 265.78 g/mol. Its IUPAC name is diethyl-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]-methylazanium chloride.
| Compound Name | diethyl-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]-methylazanium chloride |
|---|---|
| PubChem CID | 19800674 |
| Molecular Formula | C12H24ClNO3 |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | diethyl-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]-methylazanium chloride |
| SMILES | C=C(C)C(=O)OCC(O)C[N+](C)(CC)CC.[Cl-] |
| InChI | InChI=1S/C12H24NO3.ClH/c1-6-13(5,7-2)8-11(14)9-16-12(15)10(3)4;/h11,14H,3,6-9H2,1-2,4-5H3;1H/q+1;/p-1 |
| InChIKey | DOMZHHGNMGSFQG-UHFFFAOYSA-M |
| XLogP | -2.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|