C11H21O7P — CID 101236796
(3-diethoxyphosphoryloxy-2-hydroxypropyl) 2-methylprop-2-enoate (PubChem CID 101236796) has the molecular formula C11H21O7P and a molecular weight of 296.26 g/mol. Its IUPAC name is (3-diethoxyphosphoryloxy-2-hydroxypropyl) 2-methylprop-2-enoate.
| Compound Name | (3-diethoxyphosphoryloxy-2-hydroxypropyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 101236796 |
| Molecular Formula | C11H21O7P |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (3-diethoxyphosphoryloxy-2-hydroxypropyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COP(=O)(OCC)OCC |
| InChI | InChI=1S/C11H21O7P/c1-5-16-19(14,17-6-2)18-8-10(12)7-15-11(13)9(3)4/h10,12H,3,5-8H2,1-2,4H3 |
| InChIKey | GDRCUVOMOYRHQB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|