C15H22Br2O6 — CID 88638317
[3,3-dibromo-2-[[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]methyl]propyl] 2-methylprop-2-enoate (PubChem CID 88638317) has the molecular formula C15H22Br2O6 and a molecular weight of 458.14 g/mol. Its IUPAC name is [3,3-dibromo-2-[[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]methyl]propyl] 2-methylprop-2-enoate.
| Compound Name | [3,3-dibromo-2-[[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]methyl]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88638317 |
| Molecular Formula | C15H22Br2O6 |
| Molecular Weight | 458.14 g/mol |
| Exact Mass | 455.98 |
| IUPAC Name | [3,3-dibromo-2-[[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]methyl]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COCC(COC(=O)C(=C)C)C(Br)Br |
| InChI | InChI=1S/C15H22Br2O6/c1-9(2)14(19)22-6-11(13(16)17)5-21-7-12(18)8-23-15(20)10(3)4/h11-13,18H,1,3,5-8H2,2,4H3 |
| InChIKey | HLPHSZSYARLCHK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.14 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|