C20H38O9Si2 — CID 154406838
[2-hydroxy-3-[3-[3-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]propylsilyloxysilyl]propoxy]propyl] 2-methylprop-2-enoate (PubChem CID 154406838) has the molecular formula C20H38O9Si2 and a molecular weight of 478.69 g/mol. Its IUPAC name is [2-hydroxy-3-[3-[3-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]propylsilyloxysilyl]propoxy]propyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-[3-[3-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]propylsilyloxysilyl]propoxy]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154406838 |
| Molecular Formula | C20H38O9Si2 |
| Molecular Weight | 478.69 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | [2-hydroxy-3-[3-[3-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]propylsilyloxysilyl]propoxy]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COCCC[SiH2]O[SiH2]CCCOCC(O)COC(=O)C(=C)C |
| InChI | InChI=1S/C20H38O9Si2/c1-15(2)19(23)27-13-17(21)11-25-7-5-9-30-29-31-10-6-8-26-12-18(22)14-28-20(24)16(3)4/h17-18,21-22H,1,3,5-14,30-31H2,2,4H3 |
| InChIKey | GYKODPRMFYUSLP-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.69 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|