C18H38O5Si2 — CID 23527263
[3-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]-2-hydroxypropyl] 2-methylprop-2-enoate (PubChem CID 23527263) has the molecular formula C18H38O5Si2 and a molecular weight of 390.67 g/mol. Its IUPAC name is [3-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]-2-hydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]-2-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 23527263 |
| Molecular Formula | C18H38O5Si2 |
| Molecular Weight | 390.67 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | [3-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]-2-hydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COCCC[Si](C)(C)O[Si](C)(C)CCCC |
| InChI | InChI=1S/C18H38O5Si2/c1-8-9-12-24(4,5)23-25(6,7)13-10-11-21-14-17(19)15-22-18(20)16(2)3/h17,19H,2,8-15H2,1,3-7H3 |
| InChIKey | QHYDIHXWXJJFHY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.67 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|