C19H40O6Si3 — CID 177268726
CID 177268726 (PubChem CID 177268726) has the molecular formula C19H40O6Si3 and a molecular weight of 448.78 g/mol.
| Compound Name | CID 177268726 |
|---|---|
| PubChem CID | 177268726 |
| Molecular Formula | C19H40O6Si3 |
| Molecular Weight | 448.78 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)OCC(CO)COCCC[Si](C)(C)O[Si]O[Si](C)(C)CCCC |
| InChI | InChI=1S/C19H40O6Si3/c1-8-9-12-27(4,5)24-26-25-28(6,7)13-10-11-22-15-18(14-20)16-23-19(21)17(2)3/h18,20H,2,8-16H2,1,3-7H3 |
| InChIKey | SFAZEAWUNILVLX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.78 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|