C15H30O4Si — CID 139816501
3-[3-[dimethyl(propoxy)silyl]propoxy]propyl 2-methylprop-2-enoate (PubChem CID 139816501) has the molecular formula C15H30O4Si and a molecular weight of 302.49 g/mol. Its IUPAC name is 3-[3-[dimethyl(propoxy)silyl]propoxy]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[3-[dimethyl(propoxy)silyl]propoxy]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139816501 |
| Molecular Formula | C15H30O4Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 3-[3-[dimethyl(propoxy)silyl]propoxy]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCOCCC[Si](C)(C)OCCC |
| InChI | InChI=1S/C15H30O4Si/c1-6-9-19-20(4,5)13-8-11-17-10-7-12-18-15(16)14(2)3/h2,6-13H2,1,3-5H3 |
| InChIKey | XDMQVFHLZOKZCG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|