C24H56O8Si5 — CID 102146077
[1-[3-[[[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]-3-hydroxypropan-2-yl] 2-methylprop-2-enoate (PubChem CID 102146077) has the molecular formula C24H56O8Si5 and a molecular weight of 613.13 g/mol. Its IUPAC name is [1-[3-[[[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]-3-hydroxypropan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-[3-[[[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]-3-hydroxypropan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102146077 |
| Molecular Formula | C24H56O8Si5 |
| Molecular Weight | 613.13 g/mol |
| Exact Mass | 612.28 |
| IUPAC Name | [1-[3-[[[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]-3-hydroxypropan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CO)COCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCC |
| InChI | InChI=1S/C24H56O8Si5/c1-14-15-18-33(4,5)29-35(8,9)31-37(12,13)32-36(10,11)30-34(6,7)19-16-17-27-21-23(20-25)28-24(26)22(2)3/h23,25H,2,14-21H2,1,3-13H3 |
| InChIKey | BUAPCAVSGHSLQE-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.13 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|